C20H31BrO — CID 22882724
(1S,4S)-4-[(2R)-2-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-ol (PubChem CID 22882724) has the molecular formula C20H31BrO and a molecular weight of 367.37 g/mol. Its IUPAC name is (1S,4S)-4-[(2R)-2-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-ol.
| Compound Name | (1S,4S)-4-[(2R)-2-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 22882724 |
| Molecular Formula | C20H31BrO |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (1S,4S)-4-[(2R)-2-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-ol |
| SMILES | C[C@H](C[C@@H]1C=C[C@@](C)(O)C1)[C@H]1CCC2/C(=C/Br)CCC[C@@]21C |
| InChI | InChI=1S/C20H31BrO/c1-14(11-15-8-10-19(2,22)12-15)17-6-7-18-16(13-21)5-4-9-20(17,18)3/h8,10,13-15,17-18,22H,4-7,9,11-12H2,1-3H3/b16-13+/t14-,15+,17-,18?,19-,20-/m1/s1 |
| InChIKey | NGGJOHWFRNXIGJ-PBHQVWEUSA-N |
| XLogP | 5.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|