C21H35BrO4 — CID 22882733
(2R,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-(methoxymethoxy)-2-methylheptanoic acid (PubChem CID 22882733) has the molecular formula C21H35BrO4 and a molecular weight of 431.41 g/mol. Its IUPAC name is (2R,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-(methoxymethoxy)-2-methylheptanoic acid.
| Compound Name | (2R,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-(methoxymethoxy)-2-methylheptanoic acid |
|---|---|
| PubChem CID | 22882733 |
| Molecular Formula | C21H35BrO4 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (2R,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-(methoxymethoxy)-2-methylheptanoic acid |
| SMILES | COCO[C@](C)(CCC[C@@H](C)[C@H]1CCC2/C(=C/Br)CCC[C@@]21C)C(=O)O |
| InChI | InChI=1S/C21H35BrO4/c1-15(7-5-12-21(3,19(23)24)26-14-25-4)17-9-10-18-16(13-22)8-6-11-20(17,18)2/h13,15,17-18H,5-12,14H2,1-4H3,(H,23,24)/b16-13+/t15-,17-,18?,20-,21-/m1/s1 |
| InChIKey | WZQAGDAUILVTSR-RCMJLMOBSA-N |
| XLogP | 5.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|