C22H39BrO3Si — CID 22882735
(2R,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methyl-2-trimethylsilyloxyheptanoic acid (PubChem CID 22882735) has the molecular formula C22H39BrO3Si and a molecular weight of 459.54 g/mol. Its IUPAC name is (2R,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methyl-2-trimethylsilyloxyheptanoic acid.
| Compound Name | (2R,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methyl-2-trimethylsilyloxyheptanoic acid |
|---|---|
| PubChem CID | 22882735 |
| Molecular Formula | C22H39BrO3Si |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | (2R,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methyl-2-trimethylsilyloxyheptanoic acid |
| SMILES | C[C@H](CCC[C@@](C)(O[Si](C)(C)C)C(=O)O)[C@H]1CCC2/C(=C/Br)CCC[C@@]21C |
| InChI | InChI=1S/C22H39BrO3Si/c1-16(9-7-14-22(3,20(24)25)26-27(4,5)6)18-11-12-19-17(15-23)10-8-13-21(18,19)2/h15-16,18-19H,7-14H2,1-6H3,(H,24,25)/b17-15+/t16-,18-,19?,21-,22-/m1/s1 |
| InChIKey | UUBJAVRWKNJYCZ-KJKLDPADSA-N |
| XLogP | 6.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|