C19H31BrO3 — CID 22882739
(2S,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoic acid (PubChem CID 22882739) has the molecular formula C19H31BrO3 and a molecular weight of 387.36 g/mol. Its IUPAC name is (2S,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoic acid.
| Compound Name | (2S,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoic acid |
|---|---|
| PubChem CID | 22882739 |
| Molecular Formula | C19H31BrO3 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (2S,6R)-6-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoic acid |
| SMILES | C[C@H](CCC[C@](C)(O)C(=O)O)[C@H]1CCC2/C(=C/Br)CCC[C@@]21C |
| InChI | InChI=1S/C19H31BrO3/c1-13(6-4-11-19(3,23)17(21)22)15-8-9-16-14(12-20)7-5-10-18(15,16)2/h12-13,15-16,23H,4-11H2,1-3H3,(H,21,22)/b14-12+/t13-,15-,16?,18-,19+/m1/s1 |
| InChIKey | BBQMJICBHWMBCC-HAKJHKBGSA-N |
| XLogP | 5.12 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |