C22H21ClF3N5O5S2 — CID 22883566
3-[[(3S)-3-[(5-chlorothieno[3,2-b]pyridin-2-yl)sulfonyl-methylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 22883566) has the molecular formula C22H21ClF3N5O5S2 and a molecular weight of 592.02 g/mol. Its IUPAC name is 3-[[(3S)-3-[(5-chlorothieno[3,2-b]pyridin-2-yl)sulfonyl-methylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[(3S)-3-[(5-chlorothieno[3,2-b]pyridin-2-yl)sulfonyl-methylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22883566 |
| Molecular Formula | C22H21ClF3N5O5S2 |
| Molecular Weight | 592.02 g/mol |
| Exact Mass | 591.06 |
| IUPAC Name | 3-[[(3S)-3-[(5-chlorothieno[3,2-b]pyridin-2-yl)sulfonyl-methylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(CN2CC[C@H](N(C)S(=O)(=O)c3cc4nc(Cl)ccc4s3)C2=O)c1 |
| InChI | InChI=1S/C20H20ClN5O3S2.C2HF3O2/c1-25(31(28,29)18-10-14-16(30-18)5-6-17(21)24-14)15-7-8-26(20(15)27)11-12-3-2-4-13(9-12)19(22)23;3-2(4,5)1(6)7/h2-6,9-10,15H,7-8,11H2,1H3,(H3,22,23);(H,6,7)/t15-;/m0./s1 |
| InChIKey | HLHGTHOFCXEADD-RSAXXLAASA-N |
| XLogP | 3.29 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.02 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|