C23H21F6N5O7S2 — CID 22883584
3-[[(3S)-2-oxo-3-(thieno[3,2-b]pyridin-2-ylsulfonylamino)pyrrolidin-1-yl]methyl]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 22883584) has the molecular formula C23H21F6N5O7S2 and a molecular weight of 657.57 g/mol. Its IUPAC name is 3-[[(3S)-2-oxo-3-(thieno[3,2-b]pyridin-2-ylsulfonylamino)pyrrolidin-1-yl]methyl]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-[[(3S)-2-oxo-3-(thieno[3,2-b]pyridin-2-ylsulfonylamino)pyrrolidin-1-yl]methyl]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 22883584 |
| Molecular Formula | C23H21F6N5O7S2 |
| Molecular Weight | 657.57 g/mol |
| Exact Mass | 657.08 |
| IUPAC Name | 3-[[(3S)-2-oxo-3-(thieno[3,2-b]pyridin-2-ylsulfonylamino)pyrrolidin-1-yl]methyl]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(CN2CC[C@H](NS(=O)(=O)c3cc4ncccc4s3)C2=O)c1 |
| InChI | InChI=1S/C19H19N5O3S2.2C2HF3O2/c20-18(21)13-4-1-3-12(9-13)11-24-8-6-14(19(24)25)23-29(26,27)17-10-15-16(28-17)5-2-7-22-15;2*3-2(4,5)1(6)7/h1-5,7,9-10,14,23H,6,8,11H2,(H3,20,21);2*(H,6,7)/t14-;;/m0../s1 |
| InChIKey | LESJIZZDNCPAAZ-UTLKBRERSA-N |
| XLogP | 2.93 |
| TPSA | 203.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|