C21H17ClF3N5O5S2 — CID 22883610
[4-carbamimidoyl-2-[[(3S)-3-[(4-chlorothieno[3,2-c]pyridin-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 22883610) has the molecular formula C21H17ClF3N5O5S2 and a molecular weight of 575.98 g/mol. Its IUPAC name is [4-carbamimidoyl-2-[[(3S)-3-[(4-chlorothieno[3,2-c]pyridin-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-carbamimidoyl-2-[[(3S)-3-[(4-chlorothieno[3,2-c]pyridin-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 22883610 |
| Molecular Formula | C21H17ClF3N5O5S2 |
| Molecular Weight | 575.98 g/mol |
| Exact Mass | 575.03 |
| IUPAC Name | [4-carbamimidoyl-2-[[(3S)-3-[(4-chlorothieno[3,2-c]pyridin-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)C(F)(F)F)c(CN2CC[C@H](NS(=O)(=O)c3cc4c(Cl)nccc4s3)C2=O)c1 |
| InChI | InChI=1S/C21H17ClF3N5O5S2/c22-17-12-8-16(36-15(12)3-5-28-17)37(33,34)29-13-4-6-30(19(13)31)9-11-7-10(18(26)27)1-2-14(11)35-20(32)21(23,24)25/h1-3,5,7-8,13,29H,4,6,9H2,(H3,26,27)/t13-/m0/s1 |
| InChIKey | RFSDXPKFJREWJS-ZDUSSCGKSA-N |
| XLogP | 2.78 |
| TPSA | 155.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.98 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|