C35H66O6SSi2 — CID 22883780
6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid (PubChem CID 22883780) has the molecular formula C35H66O6SSi2 and a molecular weight of 671.15 g/mol. Its IUPAC name is 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid.
| Compound Name | 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 22883780 |
| Molecular Formula | C35H66O6SSi2 |
| Molecular Weight | 671.15 g/mol |
| Exact Mass | 670.41 |
| IUPAC Name | 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1C(SCCCCCC(=O)O)=C(OC(=O)CCC)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H66O6SSi2/c1-13-15-17-21-27(40-43(9,10)34(3,4)5)23-24-28-29(41-44(11,12)35(6,7)8)26-30(39-32(38)20-14-2)33(28)42-25-19-16-18-22-31(36)37/h23-24,27-29H,13-22,25-26H2,1-12H3,(H,36,37)/b24-23+/t27-,28-,29+/m0/s1 |
| InChIKey | CBPKDJLCGLFXIN-CYEYXGKASA-N |
| XLogP | 10.86 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.15 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|