C38H70O6SSi2 — CID 22883784
prop-2-enyl 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-yl]sulfanylhexanoate (PubChem CID 22883784) has the molecular formula C38H70O6SSi2 and a molecular weight of 711.21 g/mol. Its IUPAC name is prop-2-enyl 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-yl]sulfanylhexanoate.
| Compound Name | prop-2-enyl 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 22883784 |
| Molecular Formula | C38H70O6SSi2 |
| Molecular Weight | 711.21 g/mol |
| Exact Mass | 710.44 |
| IUPAC Name | prop-2-enyl 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-yl]sulfanylhexanoate |
| SMILES | C=CCOC(=O)CCCCCSC1=C(OC(=O)CCC)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H70O6SSi2/c1-14-17-19-23-30(43-46(10,11)37(4,5)6)25-26-31-32(44-47(12,13)38(7,8)9)29-33(42-35(40)22-15-2)36(31)45-28-21-18-20-24-34(39)41-27-16-3/h16,25-26,30-32H,3,14-15,17-24,27-29H2,1-2,4-13H3/b26-25+/t30-,31-,32+/m0/s1 |
| InChIKey | CWVITZZBMSUBBA-ZFVRTYBQSA-N |
| XLogP | 11.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.21 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|