C41H78O6SSi2 — CID 22883786
butyl 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate (PubChem CID 22883786) has the molecular formula C41H78O6SSi2 and a molecular weight of 755.31 g/mol. Its IUPAC name is butyl 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate.
| Compound Name | butyl 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 22883786 |
| Molecular Formula | C41H78O6SSi2 |
| Molecular Weight | 755.31 g/mol |
| Exact Mass | 754.51 |
| IUPAC Name | butyl 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate |
| SMILES | CCCCOC(=O)CCCCCSC1=C(OC(=O)CCC)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1/C=C/[C@H](C[C@H](C)CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C41H78O6SSi2/c1-15-18-24-32(4)30-33(46-49(11,12)40(5,6)7)26-27-34-35(47-50(13,14)41(8,9)10)31-36(45-38(43)23-17-3)39(34)48-29-22-20-21-25-37(42)44-28-19-16-2/h26-27,32-35H,15-25,28-31H2,1-14H3/b27-26+/t32-,33-,34+,35-/m1/s1 |
| InChIKey | LANBMADACZCDDZ-QVHDBRBTSA-N |
| XLogP | 12.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.31 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|