C36H68O6SSi2 — CID 22883789
methyl 6-[(4R,5S)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate (PubChem CID 22883789) has the molecular formula C36H68O6SSi2 and a molecular weight of 685.17 g/mol. Its IUPAC name is methyl 6-[(4R,5S)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate.
| Compound Name | methyl 6-[(4R,5S)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 22883789 |
| Molecular Formula | C36H68O6SSi2 |
| Molecular Weight | 685.17 g/mol |
| Exact Mass | 684.43 |
| IUPAC Name | methyl 6-[(4R,5S)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate |
| SMILES | CCCC[C@@H](C)C[C@@H](/C=C/[C@@H]1C(SCCCCCC(=O)OC)=C(OC(C)=O)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H68O6SSi2/c1-15-16-20-27(2)25-29(41-44(11,12)35(4,5)6)22-23-30-31(42-45(13,14)36(7,8)9)26-32(40-28(3)37)34(30)43-24-19-17-18-21-33(38)39-10/h22-23,27,29-31H,15-21,24-26H2,1-14H3/b23-22+/t27-,29-,30+,31-/m1/s1 |
| InChIKey | MHRBSJKYVPMCFU-GSFRQMJHSA-N |
| XLogP | 10.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.17 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|