C41H70O6SSi2 — CID 22883791
[(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(6-methoxy-6-oxohexyl)sulfanylcyclopenten-1-yl] benzoate (PubChem CID 22883791) has the molecular formula C41H70O6SSi2 and a molecular weight of 747.24 g/mol. Its IUPAC name is [(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(6-methoxy-6-oxohexyl)sulfanylcyclopenten-1-yl] benzoate.
| Compound Name | [(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(6-methoxy-6-oxohexyl)sulfanylcyclopenten-1-yl] benzoate |
|---|---|
| PubChem CID | 22883791 |
| Molecular Formula | C41H70O6SSi2 |
| Molecular Weight | 747.24 g/mol |
| Exact Mass | 746.44 |
| IUPAC Name | [(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(6-methoxy-6-oxohexyl)sulfanylcyclopenten-1-yl] benzoate |
| SMILES | CCCC[C@@H](C)C[C@@H](/C=C/[C@@H]1C(SCCCCCC(=O)OC)=C(OC(=O)c2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C41H70O6SSi2/c1-14-15-22-31(2)29-33(46-49(10,11)40(3,4)5)26-27-34-35(47-50(12,13)41(6,7)8)30-36(45-39(43)32-23-18-16-19-24-32)38(34)48-28-21-17-20-25-37(42)44-9/h16,18-19,23-24,26-27,31,33-35H,14-15,17,20-22,25,28-30H2,1-13H3/b27-26+/t31-,33-,34+,35-/m1/s1 |
| InChIKey | IMELFFMPPWWZCZ-HVSKSQPISA-N |
| XLogP | 12.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.24 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|