C25H42O7S — CID 22883797
[(3S,4R)-4-hydroxy-3-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-[3-(2-methoxy-2-oxoethoxy)propylsulfanyl]cyclopenten-1-yl] butanoate (PubChem CID 22883797) has the molecular formula C25H42O7S and a molecular weight of 486.67 g/mol. Its IUPAC name is [(3S,4R)-4-hydroxy-3-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-[3-(2-methoxy-2-oxoethoxy)propylsulfanyl]cyclopenten-1-yl] butanoate.
| Compound Name | [(3S,4R)-4-hydroxy-3-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-[3-(2-methoxy-2-oxoethoxy)propylsulfanyl]cyclopenten-1-yl] butanoate |
|---|---|
| PubChem CID | 22883797 |
| Molecular Formula | C25H42O7S |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | [(3S,4R)-4-hydroxy-3-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-[3-(2-methoxy-2-oxoethoxy)propylsulfanyl]cyclopenten-1-yl] butanoate |
| SMILES | CCCC[C@@H](C)C[C@H](O)/C=C/[C@@H]1C(SCCCOCC(=O)OC)=C(OC(=O)CCC)C[C@H]1O |
| InChI | InChI=1S/C25H42O7S/c1-5-7-10-18(3)15-19(26)11-12-20-21(27)16-22(32-23(28)9-6-2)25(20)33-14-8-13-31-17-24(29)30-4/h11-12,18-21,26-27H,5-10,13-17H2,1-4H3/b12-11+/t18-,19-,20+,21-/m1/s1 |
| InChIKey | HQQYFTRBMKPSFU-FOJNIUGISA-N |
| XLogP | 4.37 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|