C38H72O6SSi2 — CID 22883798
methyl 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(2-methylpropanoyloxy)cyclopenten-1-yl]sulfanylhexanoate (PubChem CID 22883798) has the molecular formula C38H72O6SSi2 and a molecular weight of 713.23 g/mol. Its IUPAC name is methyl 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(2-methylpropanoyloxy)cyclopenten-1-yl]sulfanylhexanoate.
| Compound Name | methyl 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(2-methylpropanoyloxy)cyclopenten-1-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 22883798 |
| Molecular Formula | C38H72O6SSi2 |
| Molecular Weight | 713.23 g/mol |
| Exact Mass | 712.46 |
| IUPAC Name | methyl 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(2-methylpropanoyloxy)cyclopenten-1-yl]sulfanylhexanoate |
| SMILES | CCCC[C@@H](C)C[C@@H](/C=C/[C@@H]1C(SCCCCCC(=O)OC)=C(OC(=O)C(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H72O6SSi2/c1-16-17-21-29(4)26-30(43-46(12,13)37(5,6)7)23-24-31-32(44-47(14,15)38(8,9)10)27-33(42-36(40)28(2)3)35(31)45-25-20-18-19-22-34(39)41-11/h23-24,28-32H,16-22,25-27H2,1-15H3/b24-23+/t29-,30-,31+,32-/m1/s1 |
| InChIKey | RDTFWVDKTCJGRG-UGVIJZCKSA-N |
| XLogP | 11.44 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.23 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|