About 2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid
2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid (PubChem CID 22884231) has the molecular formula C6H9F3N2O3
and a molecular weight of 214.14 g/mol. Its IUPAC name is 2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid |
| PubChem CID | 22884231 |
| Molecular Formula | C6H9F3N2O3 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid |
| SMILES | N[C@@H](CC(=O)NCC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C6H9F3N2O3/c7-6(8,9)3(10)1-4(12)11-2-5(13)14/h3H,1-2,10H2,(H,11,12)(H,13,14)/t3-/m0/s1 |
| InChIKey | KFEHEGBJOZXEHU-VKHMYHEASA-N |
| XLogP | -0.53 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid?
The IUPAC name of 2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid (CID 22884231) is 2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid.
What is the SMILES notation for 2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid?
The canonical SMILES for 2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid is N[C@@H](CC(=O)NCC(=O)O)C(F)(F)F.
What is the InChIKey of 2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid?
The InChIKey is KFEHEGBJOZXEHU-VKHMYHEASA-N. The full InChI is InChI=1S/C6H9F3N2O3/c7-6(8,9)3(10)1-4(12)11-2-5(13)14/h3H,1-2,10H2,(H,11,12)(H,13,14)/t3-/m0/s1.
What are the key properties of 2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid?
2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid has a molecular weight of 214.14 g/mol, XLogP of -0.53, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3S)-3-amino-4,4,4-trifluorobutanoyl]amino]acetic acid is sourced from PubChem (CID 22884231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).