C20H32F2O5 — CID 22884803
(2R,4R,5R,6aS)-4-[(E)-4,4-difluoro-3-hydroxy-6-methylhept-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 22884803) has the molecular formula C20H32F2O5 and a molecular weight of 390.47 g/mol. Its IUPAC name is (2R,4R,5R,6aS)-4-[(E)-4,4-difluoro-3-hydroxy-6-methylhept-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (2R,4R,5R,6aS)-4-[(E)-4,4-difluoro-3-hydroxy-6-methylhept-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 22884803 |
| Molecular Formula | C20H32F2O5 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (2R,4R,5R,6aS)-4-[(E)-4,4-difluoro-3-hydroxy-6-methylhept-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CC(C)CC(F)(F)C(O)/C=C/[C@@H]1C2C[C@H](O)O[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C20H32F2O5/c1-12(2)11-20(21,22)17(23)7-6-13-14-9-18(24)26-16(14)10-15(13)27-19-5-3-4-8-25-19/h6-7,12-19,23-24H,3-5,8-11H2,1-2H3/b7-6+/t13-,14?,15-,16+,17?,18-,19?/m1/s1 |
| InChIKey | YWTSDSUUOACMRU-GVTOMUMXSA-N |
| XLogP | 3.24 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|