C28H40F2O5 — CID 22884822
benzyl 7-[(1R,2R,3R)-2-[(5R)-4,4-difluoro-5-methyl-3-oxooctyl]-3-hydroxy-5-oxocyclopentyl]heptanoate (PubChem CID 22884822) has the molecular formula C28H40F2O5 and a molecular weight of 494.62 g/mol. Its IUPAC name is benzyl 7-[(1R,2R,3R)-2-[(5R)-4,4-difluoro-5-methyl-3-oxooctyl]-3-hydroxy-5-oxocyclopentyl]heptanoate.
| Compound Name | benzyl 7-[(1R,2R,3R)-2-[(5R)-4,4-difluoro-5-methyl-3-oxooctyl]-3-hydroxy-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22884822 |
| Molecular Formula | C28H40F2O5 |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | benzyl 7-[(1R,2R,3R)-2-[(5R)-4,4-difluoro-5-methyl-3-oxooctyl]-3-hydroxy-5-oxocyclopentyl]heptanoate |
| SMILES | CCC[C@@H](C)C(F)(F)C(=O)CC[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H40F2O5/c1-3-11-20(2)28(29,30)26(33)17-16-23-22(24(31)18-25(23)32)14-9-4-5-10-15-27(34)35-19-21-12-7-6-8-13-21/h6-8,12-13,20,22-23,25,32H,3-5,9-11,14-19H2,1-2H3/t20-,22-,23-,25-/m1/s1 |
| InChIKey | VKRXNMRLNFZEGP-HBAHCVPVSA-N |
| XLogP | 6.06 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|