C29H46F2O7 — CID 22884839
methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E,5R)-4,4-difluoro-5-methyl-3-oxooct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate (PubChem CID 22884839) has the molecular formula C29H46F2O7 and a molecular weight of 544.68 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E,5R)-4,4-difluoro-5-methyl-3-oxooct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E,5R)-4,4-difluoro-5-methyl-3-oxooct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22884839 |
| Molecular Formula | C29H46F2O7 |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E,5R)-4,4-difluoro-5-methyl-3-oxooct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| SMILES | CCC[C@@H](C)C(F)(F)C(=O)/C=C/[C@@H]1[C@@H](CCCCCCC(=O)OC)[C@@H](OC(C)=O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C29H46F2O7/c1-5-12-20(2)29(30,31)26(33)17-16-23-22(13-8-6-7-9-14-27(34)35-4)24(37-21(3)32)19-25(23)38-28-15-10-11-18-36-28/h16-17,20,22-25,28H,5-15,18-19H2,1-4H3/b17-16+/t20-,22-,23-,24+,25-,28?/m1/s1 |
| InChIKey | DHPRIYJMHCIFJJ-BTYAJLFGSA-N |
| XLogP | 6.18 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|