About (2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide
(2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide (PubChem CID 22884872) has the molecular formula C17H32N2O2
and a molecular weight of 296.46 g/mol. Its IUPAC name is (2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide.
Molecular Properties
| Compound Name | (2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide |
| PubChem CID | 22884872 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | (2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide |
| SMILES | C=C(C)C(=O)N[C@@H](CC(C)C)C(=O)NC(C(C)C)C(C)C |
| InChI | InChI=1S/C17H32N2O2/c1-10(2)9-14(18-16(20)13(7)8)17(21)19-15(11(3)4)12(5)6/h10-12,14-15H,7,9H2,1-6,8H3,(H,18,20)(H,19,21)/t14-/m0/s1 |
| InChIKey | KMGXMPPZLZTOHP-AWEZNQCLSA-N |
| XLogP | 2.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide?
The IUPAC name of (2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide (CID 22884872) is (2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide.
What is the SMILES notation for (2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide?
The canonical SMILES for (2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide is C=C(C)C(=O)N[C@@H](CC(C)C)C(=O)NC(C(C)C)C(C)C.
What is the InChIKey of (2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide?
The InChIKey is KMGXMPPZLZTOHP-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H32N2O2/c1-10(2)9-14(18-16(20)13(7)8)17(21)19-15(11(3)4)12(5)6/h10-12,14-15H,7,9H2,1-6,8H3,(H,18,20)(H,19,21)/t14-/m0/s1.
What are the key properties of (2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide?
(2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide has a molecular weight of 296.46 g/mol, XLogP of 2.89, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-(2,4-dimethylpentan-3-yl)-4-methyl-2-(2-methylprop-2-enoylamino)pentanamide is sourced from PubChem (CID 22884872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).