C8H8N2O3S2 — CID 22884884
(6S,7R)-7-amino-3-methanethioyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22884884) has the molecular formula C8H8N2O3S2 and a molecular weight of 244.30 g/mol. Its IUPAC name is (6S,7R)-7-amino-3-methanethioyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-7-amino-3-methanethioyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22884884 |
| Molecular Formula | C8H8N2O3S2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.00 |
| IUPAC Name | (6S,7R)-7-amino-3-methanethioyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | N[C@@H]1C(=O)N2C(C(=O)O)=C(C=S)CS[C@@H]12 |
| InChI | InChI=1S/C8H8N2O3S2/c9-4-6(11)10-5(8(12)13)3(1-14)2-15-7(4)10/h1,4,7H,2,9H2,(H,12,13)/t4-,7+/m1/s1 |
| InChIKey | MJZQJHMZKALFEI-FBCQKBJTSA-N |
| XLogP | -0.43 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|