C19H17FO3 — CID 2288515
9-(3-fluorophenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 2288515) has the molecular formula C19H17FO3 and a molecular weight of 312.34 g/mol. Its IUPAC name is 9-(3-fluorophenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-(3-fluorophenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 2288515 |
| Molecular Formula | C19H17FO3 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 9-(3-fluorophenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1cccc(F)c1)C1=C(CCCC1=O)O2 |
| InChI | InChI=1S/C19H17FO3/c20-12-5-1-4-11(10-12)17-18-13(21)6-2-8-15(18)23-16-9-3-7-14(22)19(16)17/h1,4-5,10,17H,2-3,6-9H2 |
| InChIKey | FVIGCDUZVGXOGK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |