C45H90NO8P — CID 22885238
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-(10-ethyloctadecanoyloxy)propyl] 10-ethyloctadecanoate (PubChem CID 22885238) has the molecular formula C45H90NO8P and a molecular weight of 804.19 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-(10-ethyloctadecanoyloxy)propyl] 10-ethyloctadecanoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-(10-ethyloctadecanoyloxy)propyl] 10-ethyloctadecanoate |
|---|---|
| PubChem CID | 22885238 |
| Molecular Formula | C45H90NO8P |
| Molecular Weight | 804.19 g/mol |
| Exact Mass | 803.64 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-(10-ethyloctadecanoyloxy)propyl] 10-ethyloctadecanoate |
| SMILES | CCCCCCCCC(CC)CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCCCC(CC)CCCCCCCC |
| InChI | InChI=1S/C45H90NO8P/c1-5-9-11-13-19-25-31-41(7-3)33-27-21-15-17-23-29-35-44(47)51-39-43(40-53-55(49,50)52-38-37-46)54-45(48)36-30-24-18-16-22-28-34-42(8-4)32-26-20-14-12-10-6-2/h41-43H,5-40,46H2,1-4H3,(H,49,50)/t41?,42?,43-/m1/s1 |
| InChIKey | MJYZNZJFFBCVQQ-RPOUZCTQSA-N |
| XLogP | 13.33 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.19 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|