About (2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide
(2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide (PubChem CID 22885302) has the molecular formula C34H72N4O
and a molecular weight of 552.98 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide.
Molecular Properties
| Compound Name | (2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide |
| PubChem CID | 22885302 |
| Molecular Formula | C34H72N4O |
| Molecular Weight | 552.98 g/mol |
| Exact Mass | 552.57 |
| IUPAC Name | (2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide |
| SMILES | CCCCCCCCCC(CCCCCCCC)(CCCCCCCC)NCCNC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C34H72N4O/c1-4-7-10-13-16-19-23-28-34(26-21-17-14-11-8-5-2,27-22-18-15-12-9-6-3)38-31-30-37-33(39)32(36)25-20-24-29-35/h32,38H,4-31,35-36H2,1-3H3,(H,37,39)/t32-/m0/s1 |
| InChIKey | GBCZAYBIGFQWAH-YTTGMZPUSA-N |
| XLogP | 8.53 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 552.98 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide?
The IUPAC name of (2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide (CID 22885302) is (2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide.
What is the SMILES notation for (2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide?
The canonical SMILES for (2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide is CCCCCCCCCC(CCCCCCCC)(CCCCCCCC)NCCNC(=O)[C@@H](N)CCCCN.
What is the InChIKey of (2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide?
The InChIKey is GBCZAYBIGFQWAH-YTTGMZPUSA-N. The full InChI is InChI=1S/C34H72N4O/c1-4-7-10-13-16-19-23-28-34(26-21-17-14-11-8-5-2,27-22-18-15-12-9-6-3)38-31-30-37-33(39)32(36)25-20-24-29-35/h32,38H,4-31,35-36H2,1-3H3,(H,37,39)/t32-/m0/s1.
What are the key properties of (2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide?
(2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide has a molecular weight of 552.98 g/mol, XLogP of 8.53, 31 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-diamino-N-[2-(9-octyloctadecan-9-ylamino)ethyl]hexanamide is sourced from PubChem (CID 22885302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).