C24H34N4O5S2 — CID 22885468
(2S)-N-[[(2S)-3,3-dimethyl-1-oxo-1-(pyridin-2-ylamino)butan-2-yl]carbamoyl]-N-hydroxy-5-methyl-2-(thiophen-2-ylsulfinylmethyl)hexanamide (PubChem CID 22885468) has the molecular formula C24H34N4O5S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is (2S)-N-[[(2S)-3,3-dimethyl-1-oxo-1-(pyridin-2-ylamino)butan-2-yl]carbamoyl]-N-hydroxy-5-methyl-2-(thiophen-2-ylsulfinylmethyl)hexanamide.
| Compound Name | (2S)-N-[[(2S)-3,3-dimethyl-1-oxo-1-(pyridin-2-ylamino)butan-2-yl]carbamoyl]-N-hydroxy-5-methyl-2-(thiophen-2-ylsulfinylmethyl)hexanamide |
|---|---|
| PubChem CID | 22885468 |
| Molecular Formula | C24H34N4O5S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | (2S)-N-[[(2S)-3,3-dimethyl-1-oxo-1-(pyridin-2-ylamino)butan-2-yl]carbamoyl]-N-hydroxy-5-methyl-2-(thiophen-2-ylsulfinylmethyl)hexanamide |
| SMILES | CC(C)CC[C@H](CS(=O)c1cccs1)C(=O)N(O)C(=O)N[C@H](C(=O)Nc1ccccn1)C(C)(C)C |
| InChI | InChI=1S/C24H34N4O5S2/c1-16(2)11-12-17(15-35(33)19-10-8-14-34-19)22(30)28(32)23(31)27-20(24(3,4)5)21(29)26-18-9-6-7-13-25-18/h6-10,13-14,16-17,20,32H,11-12,15H2,1-5H3,(H,27,31)(H,25,26,29)/t17-,20-,35?/m1/s1 |
| InChIKey | WJLLHOWGYGXMNT-RYODODFZSA-N |
| XLogP | 4.28 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|