About (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one (PubChem CID 22885541) has the molecular formula C20H20O6
and a molecular weight of 356.37 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one.
Molecular Properties
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one |
| PubChem CID | 22885541 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(OCc2ccccc2)=C1OCc1ccccc1 |
| InChI | InChI=1S/C20H20O6/c21-11-16(22)17-18(24-12-14-7-3-1-4-8-14)19(20(23)26-17)25-13-15-9-5-2-6-10-15/h1-10,16-17,21-22H,11-13H2/t16-,17+/m0/s1 |
| InChIKey | GEIBUUPSUZXTHF-DLBZAZTESA-N |
| XLogP | 1.91 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one?
The IUPAC name of (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one (CID 22885541) is (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one.
What is the SMILES notation for (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one?
The canonical SMILES for (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one is O=C1O[C@H]([C@@H](O)CO)C(OCc2ccccc2)=C1OCc1ccccc1.
What is the InChIKey of (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one?
The InChIKey is GEIBUUPSUZXTHF-DLBZAZTESA-N. The full InChI is InChI=1S/C20H20O6/c21-11-16(22)17-18(24-12-14-7-3-1-4-8-14)19(20(23)26-17)25-13-15-9-5-2-6-10-15/h1-10,16-17,21-22H,11-13H2/t16-,17+/m0/s1.
What are the key properties of (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one?
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one has a molecular weight of 356.37 g/mol, XLogP of 1.91, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one is sourced from PubChem (CID 22885541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).