C26H39NOSi — CID 22885654
(1R,2R,3R)-N-benzyl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenylcyclohexan-1-amine (PubChem CID 22885654) has the molecular formula C26H39NOSi and a molecular weight of 409.69 g/mol. Its IUPAC name is (1R,2R,3R)-N-benzyl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenylcyclohexan-1-amine.
| Compound Name | (1R,2R,3R)-N-benzyl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenylcyclohexan-1-amine |
|---|---|
| PubChem CID | 22885654 |
| Molecular Formula | C26H39NOSi |
| Molecular Weight | 409.69 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | (1R,2R,3R)-N-benzyl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenylcyclohexan-1-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCC[C@@H](NCc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H39NOSi/c1-26(2,3)29(4,5)28-20-23-17-12-18-24(25(23)22-15-10-7-11-16-22)27-19-21-13-8-6-9-14-21/h6-11,13-16,23-25,27H,12,17-20H2,1-5H3/t23-,24+,25-/m0/s1 |
| InChIKey | ZZGMCBOGNWKEBX-GVAUOCQISA-N |
| XLogP | 6.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.69 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|