C19H20N2O2 — CID 22885983
N-[(1S)-1-[(5R)-3-benzyl-4,5-dihydro-1,2-oxazol-5-yl]-2-phenylethyl]formamide (PubChem CID 22885983) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[(1S)-1-[(5R)-3-benzyl-4,5-dihydro-1,2-oxazol-5-yl]-2-phenylethyl]formamide.
| Compound Name | N-[(1S)-1-[(5R)-3-benzyl-4,5-dihydro-1,2-oxazol-5-yl]-2-phenylethyl]formamide |
|---|---|
| PubChem CID | 22885983 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-[(1S)-1-[(5R)-3-benzyl-4,5-dihydro-1,2-oxazol-5-yl]-2-phenylethyl]formamide |
| SMILES | O=CN[C@@H](Cc1ccccc1)[C@H]1CC(Cc2ccccc2)=NO1 |
| InChI | InChI=1S/C19H20N2O2/c22-14-20-18(12-16-9-5-2-6-10-16)19-13-17(21-23-19)11-15-7-3-1-4-8-15/h1-10,14,18-19H,11-13H2,(H,20,22)/t18-,19+/m0/s1 |
| InChIKey | HEWDVBVEIPRPNL-RBUKOAKNSA-N |
| XLogP | 2.73 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|