About 2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate
2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate (PubChem CID 22886695) has the molecular formula C19H36N2O5
and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate.
Molecular Properties
| Compound Name | 2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate |
| PubChem CID | 22886695 |
| Molecular Formula | C19H36N2O5 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate |
| SMILES | CCC(CC(C)(CC(C)C(=O)OC)C(=O)NCCC[N+](C)(C)C)C(=O)[O-] |
| InChI | InChI=1S/C19H36N2O5/c1-8-15(16(22)23)13-19(3,12-14(2)17(24)26-7)18(25)20-10-9-11-21(4,5)6/h14-15H,8-13H2,1-7H3,(H-,20,22,23,25) |
| InChIKey | RVGZXYXPBXZPKF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate?
The IUPAC name of 2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate (CID 22886695) is 2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate.
What is the SMILES notation for 2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate?
The canonical SMILES for 2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate is CCC(CC(C)(CC(C)C(=O)OC)C(=O)NCCC[N+](C)(C)C)C(=O)[O-].
What is the InChIKey of 2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate?
The InChIKey is RVGZXYXPBXZPKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36N2O5/c1-8-15(16(22)23)13-19(3,12-14(2)17(24)26-7)18(25)20-10-9-11-21(4,5)6/h14-15H,8-13H2,1-7H3,(H-,20,22,23,25).
What are the key properties of 2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate?
2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate has a molecular weight of 372.51 g/mol, XLogP of 0.57, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-7-methoxy-4,6-dimethyl-7-oxo-4-[3-(trimethylazaniumyl)propylcarbamoyl]heptanoate is sourced from PubChem (CID 22886695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).