C12H22O5 — CID 22887044
[(4R,5S)-2,2-dimethyl-5-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-1,3-dioxolan-4-yl]methanol (PubChem CID 22887044) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is [(4R,5S)-2,2-dimethyl-5-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R,5S)-2,2-dimethyl-5-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 22887044 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | [(4R,5S)-2,2-dimethyl-5-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-1,3-dioxolan-4-yl]methanol |
| SMILES | C[C@@H]1OC(C)(C)O[C@H]1[C@H]1OC(C)(C)O[C@@H]1CO |
| InChI | InChI=1S/C12H22O5/c1-7-9(16-11(2,3)14-7)10-8(6-13)15-12(4,5)17-10/h7-10,13H,6H2,1-5H3/t7-,8+,9+,10-/m0/s1 |
| InChIKey | NYRAALXXZIFOQZ-JLIMGVALSA-N |
| XLogP | 1.04 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |