C9H14O5 — CID 22887067
(3aR,7R,7aR)-7-hydroxy-2,2,3a-trimethyl-7,7a-dihydro-6H-[1,3]dioxolo[4,5-c]pyran-4-one (PubChem CID 22887067) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is (3aR,7R,7aR)-7-hydroxy-2,2,3a-trimethyl-7,7a-dihydro-6H-[1,3]dioxolo[4,5-c]pyran-4-one.
| Compound Name | (3aR,7R,7aR)-7-hydroxy-2,2,3a-trimethyl-7,7a-dihydro-6H-[1,3]dioxolo[4,5-c]pyran-4-one |
|---|---|
| PubChem CID | 22887067 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (3aR,7R,7aR)-7-hydroxy-2,2,3a-trimethyl-7,7a-dihydro-6H-[1,3]dioxolo[4,5-c]pyran-4-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O)COC(=O)[C@]2(C)O1 |
| InChI | InChI=1S/C9H14O5/c1-8(2)13-6-5(10)4-12-7(11)9(6,3)14-8/h5-6,10H,4H2,1-3H3/t5-,6-,9-/m1/s1 |
| InChIKey | ABODPFVNICWUHY-HCVRKRLWSA-N |
| XLogP | -0.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |