C8H16O6 — CID 22887099
(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxy-3,4-dimethylhexanal (PubChem CID 22887099) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,3,4,5,6-pentahydroxy-3,4-dimethylhexanal.
| Compound Name | (2R,3R,4R,5R)-2,3,4,5,6-pentahydroxy-3,4-dimethylhexanal |
|---|---|
| PubChem CID | 22887099 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (2R,3R,4R,5R)-2,3,4,5,6-pentahydroxy-3,4-dimethylhexanal |
| SMILES | C[C@@](O)([C@H](O)CO)[C@](C)(O)[C@@H](O)C=O |
| InChI | InChI=1S/C8H16O6/c1-7(13,5(11)3-9)8(2,14)6(12)4-10/h3,5-6,10-14H,4H2,1-2H3/t5-,6+,7+,8+/m0/s1 |
| InChIKey | BTUWKBWVPKMCNO-LXGUWJNJSA-N |
| XLogP | -2.60 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|