C9H14O7 — CID 22887272
(5R)-5-methyl-5-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]oxolane-2,3-dione (PubChem CID 22887272) has the molecular formula C9H14O7 and a molecular weight of 234.20 g/mol. Its IUPAC name is (5R)-5-methyl-5-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]oxolane-2,3-dione.
| Compound Name | (5R)-5-methyl-5-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]oxolane-2,3-dione |
|---|---|
| PubChem CID | 22887272 |
| Molecular Formula | C9H14O7 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (5R)-5-methyl-5-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]oxolane-2,3-dione |
| SMILES | C[C@]1([C@@H](O)[C@H](O)[C@H](O)CO)CC(=O)C(=O)O1 |
| InChI | InChI=1S/C9H14O7/c1-9(2-4(11)8(15)16-9)7(14)6(13)5(12)3-10/h5-7,10,12-14H,2-3H2,1H3/t5-,6-,7+,9-/m1/s1 |
| InChIKey | LLNGEHACCVFIFD-JAGXHNFQSA-N |
| XLogP | -2.66 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|