C41H56N6O5+2 — CID 22887403
N-[3-[3-[3-[3-[[1-hydroxy-2-(4-phenylpyridin-1-ium-1-yl)propyl]amino]propoxy]propylcarbamoylamino]propoxy]propyl]-2-(4-phenylpyridin-1-ium-1-yl)propanamide (PubChem CID 22887403) has the molecular formula C41H56N6O5+2 and a molecular weight of 712.94 g/mol. Its IUPAC name is N-[3-[3-[3-[3-[[1-hydroxy-2-(4-phenylpyridin-1-ium-1-yl)propyl]amino]propoxy]propylcarbamoylamino]propoxy]propyl]-2-(4-phenylpyridin-1-ium-1-yl)propanamide.
| Compound Name | N-[3-[3-[3-[3-[[1-hydroxy-2-(4-phenylpyridin-1-ium-1-yl)propyl]amino]propoxy]propylcarbamoylamino]propoxy]propyl]-2-(4-phenylpyridin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 22887403 |
| Molecular Formula | C41H56N6O5+2 |
| Molecular Weight | 712.94 g/mol |
| Exact Mass | 712.43 |
| IUPAC Name | N-[3-[3-[3-[3-[[1-hydroxy-2-(4-phenylpyridin-1-ium-1-yl)propyl]amino]propoxy]propylcarbamoylamino]propoxy]propyl]-2-(4-phenylpyridin-1-ium-1-yl)propanamide |
| SMILES | CC(C(=O)NCCCOCCCNC(=O)NCCCOCCCNC(O)C(C)[n+]1ccc(-c2ccccc2)cc1)[n+]1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C41H54N6O5/c1-33(46-25-17-37(18-26-46)35-13-5-3-6-14-35)39(48)42-21-9-29-51-31-11-23-44-41(50)45-24-12-32-52-30-10-22-43-40(49)34(2)47-27-19-38(20-28-47)36-15-7-4-8-16-36/h3-8,13-20,25-28,33-34,39,42,48H,9-12,21-24,29-32H2,1-2H3,(H-2,43,44,45,49,50)/p+2 |
| InChIKey | ZARNSQCVNZVDMH-UHFFFAOYSA-P |
| XLogP | 4.33 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.94 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|