C11H7F2N3O3 — CID 2288826
5-[(3,5-difluorophenyl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 2288826) has the molecular formula C11H7F2N3O3 and a molecular weight of 267.19 g/mol. Its IUPAC name is 5-[(3,5-difluorophenyl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(3,5-difluorophenyl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2288826 |
| Molecular Formula | C11H7F2N3O3 |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 5-[(3,5-difluorophenyl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(/C=N/c2cc(F)cc(F)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H7F2N3O3/c12-5-1-6(13)3-7(2-5)14-4-8-9(17)15-11(19)16-10(8)18/h1-4H,(H3,15,16,17,18,19)/b14-4+ |
| InChIKey | JLCPJUIELODEGL-LNKIKWGQSA-N |
| XLogP | 0.80 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|