About 5-methyl-3,4-di(propan-2-yl)oxolan-2-one
5-methyl-3,4-di(propan-2-yl)oxolan-2-one (PubChem CID 22888299) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 5-methyl-3,4-di(propan-2-yl)oxolan-2-one.
Molecular Properties
| Compound Name | 5-methyl-3,4-di(propan-2-yl)oxolan-2-one |
| PubChem CID | 22888299 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 5-methyl-3,4-di(propan-2-yl)oxolan-2-one |
| SMILES | CC(C)C1C(=O)OC(C)C1C(C)C |
| InChI | InChI=1S/C11H20O2/c1-6(2)9-8(5)13-11(12)10(9)7(3)4/h6-10H,1-5H3 |
| InChIKey | PALRYPJQLWFTJS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-3,4-di(propan-2-yl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3,4-di(propan-2-yl)oxolan-2-one?
The IUPAC name of 5-methyl-3,4-di(propan-2-yl)oxolan-2-one (CID 22888299) is 5-methyl-3,4-di(propan-2-yl)oxolan-2-one.
What is the SMILES notation for 5-methyl-3,4-di(propan-2-yl)oxolan-2-one?
The canonical SMILES for 5-methyl-3,4-di(propan-2-yl)oxolan-2-one is CC(C)C1C(=O)OC(C)C1C(C)C.
What is the InChIKey of 5-methyl-3,4-di(propan-2-yl)oxolan-2-one?
The InChIKey is PALRYPJQLWFTJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-6(2)9-8(5)13-11(12)10(9)7(3)4/h6-10H,1-5H3.
What are the key properties of 5-methyl-3,4-di(propan-2-yl)oxolan-2-one?
5-methyl-3,4-di(propan-2-yl)oxolan-2-one has a molecular weight of 184.28 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3,4-di(propan-2-yl)oxolan-2-one is sourced from PubChem (CID 22888299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).