About propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate
propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate (PubChem CID 22888323) has the molecular formula C24H22Cl2N2O3
and a molecular weight of 457.36 g/mol. Its IUPAC name is propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 22888323 |
| Molecular Formula | C24H22Cl2N2O3 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COCc1c(C(=O)OC(C)C)ncc2c1c1ccccc1n2Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C24H22Cl2N2O3/c1-14(2)31-24(29)23-18(13-30-3)22-17-6-4-5-7-20(17)28(21(22)11-27-23)12-15-10-16(25)8-9-19(15)26/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | FUIIJBVIUYFIJV-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate (CID 22888323) is propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate is COCc1c(C(=O)OC(C)C)ncc2c1c1ccccc1n2Cc1cc(Cl)ccc1Cl.
What is the InChIKey of propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is FUIIJBVIUYFIJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22Cl2N2O3/c1-14(2)31-24(29)23-18(13-30-3)22-17-6-4-5-7-20(17)28(21(22)11-27-23)12-15-10-16(25)8-9-19(15)26/h4-11,14H,12-13H2,1-3H3.
What are the key properties of propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate?
propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 457.36 g/mol, XLogP of 6.26, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 9-[(2,5-dichlorophenyl)methyl]-4-(methoxymethyl)pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 22888323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).