C12H22N4O2 — CID 22888540
2-(3-amino-2-oxopyrrolidin-1-yl)-N-[3-(prop-1-en-2-ylamino)propyl]acetamide (PubChem CID 22888540) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-(3-amino-2-oxopyrrolidin-1-yl)-N-[3-(prop-1-en-2-ylamino)propyl]acetamide.
| Compound Name | 2-(3-amino-2-oxopyrrolidin-1-yl)-N-[3-(prop-1-en-2-ylamino)propyl]acetamide |
|---|---|
| PubChem CID | 22888540 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2-(3-amino-2-oxopyrrolidin-1-yl)-N-[3-(prop-1-en-2-ylamino)propyl]acetamide |
| SMILES | C=C(C)NCCCNC(=O)CN1CCC(N)C1=O |
| InChI | InChI=1S/C12H22N4O2/c1-9(2)14-5-3-6-15-11(17)8-16-7-4-10(13)12(16)18/h10,14H,1,3-8,13H2,2H3,(H,15,17) |
| InChIKey | WOJJNHORNPGVMN-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|