C45H38O18 — CID 22889021
2-(3,4-dihydroxyphenyl)-6,8-bis[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 22889021) has the molecular formula C45H38O18 and a molecular weight of 866.78 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-6,8-bis[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | 2-(3,4-dihydroxyphenyl)-6,8-bis[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 22889021 |
| Molecular Formula | C45H38O18 |
| Molecular Weight | 866.78 g/mol |
| Exact Mass | 866.21 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-6,8-bis[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | Oc1cc(O)c2c(c1)OC(c1ccc(O)c(O)c1)C(O)C2c1c(O)c2c(c(C3c4c(O)cc(O)cc4OC(c4ccc(O)c(O)c4)C3O)c1O)OC(c1ccc(O)c(O)c1)C(O)C2 |
| InChI | InChI=1S/C45H38O18/c46-18-10-27(54)32-30(12-18)61-43(16-2-5-22(49)25(52)8-16)40(59)34(32)36-38(57)20-14-29(56)42(15-1-4-21(48)24(51)7-15)63-45(20)37(39(36)58)35-33-28(55)11-19(47)13-31(33)62-44(41(35)60)17-3-6-23(50)26(53)9-17/h1-13,29,34-35,40-44,46-60H,14H2 |
| InChIKey | IKTZKPJUCZXHLC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 331.14 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.78 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|