About N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide
N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide (PubChem CID 22889127) has the molecular formula C13H24N4O4
and a molecular weight of 300.36 g/mol. Its IUPAC name is N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide.
Molecular Properties
| Compound Name | N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide |
| PubChem CID | 22889127 |
| Molecular Formula | C13H24N4O4 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide |
| SMILES | CN(C)C(=O)CC(=O)N(C)CN(C)C(=O)CC(=O)N(C)C |
| InChI | InChI=1S/C13H24N4O4/c1-14(2)10(18)7-12(20)16(5)9-17(6)13(21)8-11(19)15(3)4/h7-9H2,1-6H3 |
| InChIKey | ZLOJEAKVCKKSBE-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide?
The IUPAC name of N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide (CID 22889127) is N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide.
What is the SMILES notation for N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide?
The canonical SMILES for N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide is CN(C)C(=O)CC(=O)N(C)CN(C)C(=O)CC(=O)N(C)C.
What is the InChIKey of N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide?
The InChIKey is ZLOJEAKVCKKSBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4O4/c1-14(2)10(18)7-12(20)16(5)9-17(6)13(21)8-11(19)15(3)4/h7-9H2,1-6H3.
What are the key properties of N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide?
N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide has a molecular weight of 300.36 g/mol, XLogP of -1.18, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[[3-(dimethylamino)-3-oxopropanoyl]-methylamino]methyl]-N,N,N'-trimethylpropanediamide is sourced from PubChem (CID 22889127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).