About 3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol
3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol (PubChem CID 22889171) has the molecular formula C15H30N2O4
and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol |
| PubChem CID | 22889171 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol |
| SMILES | C=CCN(CC(O)CO)CC(C)N(CC=C)CC(O)CO |
| InChI | InChI=1S/C15H30N2O4/c1-4-6-16(9-14(20)11-18)8-13(3)17(7-5-2)10-15(21)12-19/h4-5,13-15,18-21H,1-2,6-12H2,3H3 |
| InChIKey | WUJIZMVWGXCMLO-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol?
The IUPAC name of 3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol (CID 22889171) is 3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol.
What is the SMILES notation for 3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol?
The canonical SMILES for 3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol is C=CCN(CC(O)CO)CC(C)N(CC=C)CC(O)CO.
What is the InChIKey of 3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol?
The InChIKey is WUJIZMVWGXCMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O4/c1-4-6-16(9-14(20)11-18)8-13(3)17(7-5-2)10-15(21)12-19/h4-5,13-15,18-21H,1-2,6-12H2,3H3.
What are the key properties of 3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol?
3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol has a molecular weight of 302.42 g/mol, XLogP of -0.94, 13 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2,3-dihydroxypropyl(prop-2-enyl)amino]propyl-prop-2-enylamino]propane-1,2-diol is sourced from PubChem (CID 22889171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).