C15H27N3O6 — CID 22889203
methyl 2-[4,7-bis(2-methoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]acetate (PubChem CID 22889203) has the molecular formula C15H27N3O6 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl 2-[4,7-bis(2-methoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]acetate.
| Compound Name | methyl 2-[4,7-bis(2-methoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]acetate |
|---|---|
| PubChem CID | 22889203 |
| Molecular Formula | C15H27N3O6 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | methyl 2-[4,7-bis(2-methoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(CC(=O)OC)CCN(CC(=O)OC)CC1 |
| InChI | InChI=1S/C15H27N3O6/c1-22-13(19)10-16-4-6-17(11-14(20)23-2)8-9-18(7-5-16)12-15(21)24-3/h4-12H2,1-3H3 |
| InChIKey | XMSMAVJBPXKCLO-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|