C45H59FO11 — CID 22889272
20-[2-(4-fluorophenyl)-2-hydroxyethyl]-21-methoxy-14-methyl-8,15-dimethylidene-2,19,30,34,37,39,40,41-octaoxanonacyclo[24.9.2.13,32.13,33.16,9.112,16.018,22.029,36.031,35]hentetracontan-24-one (PubChem CID 22889272) has the molecular formula C45H59FO11 and a molecular weight of 794.95 g/mol. Its IUPAC name is 20-[2-(4-fluorophenyl)-2-hydroxyethyl]-21-methoxy-14-methyl-8,15-dimethylidene-2,19,30,34,37,39,40,41-octaoxanonacyclo[24.9.2.13,32.13,33.16,9.112,16.018,22.029,36.031,35]hentetracontan-24-one.
| Compound Name | 20-[2-(4-fluorophenyl)-2-hydroxyethyl]-21-methoxy-14-methyl-8,15-dimethylidene-2,19,30,34,37,39,40,41-octaoxanonacyclo[24.9.2.13,32.13,33.16,9.112,16.018,22.029,36.031,35]hentetracontan-24-one |
|---|---|
| PubChem CID | 22889272 |
| Molecular Formula | C45H59FO11 |
| Molecular Weight | 794.95 g/mol |
| Exact Mass | 794.40 |
| IUPAC Name | 20-[2-(4-fluorophenyl)-2-hydroxyethyl]-21-methoxy-14-methyl-8,15-dimethylidene-2,19,30,34,37,39,40,41-octaoxanonacyclo[24.9.2.13,32.13,33.16,9.112,16.018,22.029,36.031,35]hentetracontan-24-one |
| SMILES | C=C1CC2CCC34CC5OC6C(OC7CCC(CC(=O)CC8C(CC9OC(CCC1O2)CC(C)C9=C)OC(CC(O)c1ccc(F)cc1)C8OC)OC7C6O3)C5O4 |
| InChI | InChI=1S/C45H59FO11/c1-22-15-28-9-11-33-23(2)16-30(50-33)13-14-45-21-38-41(56-45)42-43(55-38)44(57-45)40-34(54-42)12-10-29(52-40)17-27(47)18-31-36(20-35(51-28)24(22)3)53-37(39(31)49-4)19-32(48)25-5-7-26(46)8-6-25/h5-8,22,28-44,48H,2-3,9-21H2,1,4H3 |
| InChIKey | PYFRPUBHOCWWRB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.95 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|