C10H10BrCl3 — CID 22889382
5-bromo-1,3-dimethyl-2-(2,2,2-trichloroethyl)benzene (PubChem CID 22889382) has the molecular formula C10H10BrCl3 and a molecular weight of 316.45 g/mol. Its IUPAC name is 5-bromo-1,3-dimethyl-2-(2,2,2-trichloroethyl)benzene.
| Compound Name | 5-bromo-1,3-dimethyl-2-(2,2,2-trichloroethyl)benzene |
|---|---|
| PubChem CID | 22889382 |
| Molecular Formula | C10H10BrCl3 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 313.90 |
| IUPAC Name | 5-bromo-1,3-dimethyl-2-(2,2,2-trichloroethyl)benzene |
| SMILES | Cc1cc(Br)cc(C)c1CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H10BrCl3/c1-6-3-8(11)4-7(2)9(6)5-10(12,13)14/h3-4H,5H2,1-2H3 |
| InChIKey | GTHKJQCUTPBJST-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|