C17H24O4 — CID 22889391
(9,10-dihydroxy-4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)methyl prop-2-enoate (PubChem CID 22889391) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (9,10-dihydroxy-4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)methyl prop-2-enoate.
| Compound Name | (9,10-dihydroxy-4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 22889391 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (9,10-dihydroxy-4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(C)CC2CC1C1C3CC(C(O)C3O)C21 |
| InChI | InChI=1S/C17H24O4/c1-3-12(18)21-7-17(2)6-8-4-11(17)14-10-5-9(13(8)14)15(19)16(10)20/h3,8-11,13-16,19-20H,1,4-7H2,2H3 |
| InChIKey | YUOKQMUEYSBRDY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|