C17H20ClN7+2 — CID 22889564
6-chloro-2-N,4-N-bis(2-pyridin-1-ium-1-ylethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 22889564) has the molecular formula C17H20ClN7+2 and a molecular weight of 357.85 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-bis(2-pyridin-1-ium-1-ylethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,4-N-bis(2-pyridin-1-ium-1-ylethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 22889564 |
| Molecular Formula | C17H20ClN7+2 |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 6-chloro-2-N,4-N-bis(2-pyridin-1-ium-1-ylethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Clc1nc(NCC[n+]2ccccc2)nc(NCC[n+]2ccccc2)n1 |
| InChI | InChI=1S/C17H20ClN7/c18-15-21-16(19-7-13-24-9-3-1-4-10-24)23-17(22-15)20-8-14-25-11-5-2-6-12-25/h1-6,9-12H,7-8,13-14H2,(H2,19,20,21,22,23)/q+2 |
| InChIKey | HUBSUZXDQDNDHH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 70.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|