About 2,4-dichloro-1,3,6-trimethyl-2H-pyridine
2,4-dichloro-1,3,6-trimethyl-2H-pyridine (PubChem CID 22890213) has the molecular formula C8H11Cl2N
and a molecular weight of 192.09 g/mol. Its IUPAC name is 2,4-dichloro-1,3,6-trimethyl-2H-pyridine.
Molecular Properties
| Compound Name | 2,4-dichloro-1,3,6-trimethyl-2H-pyridine |
| PubChem CID | 22890213 |
| Molecular Formula | C8H11Cl2N |
| Molecular Weight | 192.09 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 2,4-dichloro-1,3,6-trimethyl-2H-pyridine |
| SMILES | CC1=CC(Cl)=C(C)C(Cl)N1C |
| InChI | InChI=1S/C8H11Cl2N/c1-5-4-7(9)6(2)8(10)11(5)3/h4,8H,1-3H3 |
| InChIKey | KYOOUNGMEJYKGI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.09 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-1,3,6-trimethyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-1,3,6-trimethyl-2H-pyridine?
The IUPAC name of 2,4-dichloro-1,3,6-trimethyl-2H-pyridine (CID 22890213) is 2,4-dichloro-1,3,6-trimethyl-2H-pyridine.
What is the SMILES notation for 2,4-dichloro-1,3,6-trimethyl-2H-pyridine?
The canonical SMILES for 2,4-dichloro-1,3,6-trimethyl-2H-pyridine is CC1=CC(Cl)=C(C)C(Cl)N1C.
What is the InChIKey of 2,4-dichloro-1,3,6-trimethyl-2H-pyridine?
The InChIKey is KYOOUNGMEJYKGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11Cl2N/c1-5-4-7(9)6(2)8(10)11(5)3/h4,8H,1-3H3.
What are the key properties of 2,4-dichloro-1,3,6-trimethyl-2H-pyridine?
2,4-dichloro-1,3,6-trimethyl-2H-pyridine has a molecular weight of 192.09 g/mol, XLogP of 2.91, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-1,3,6-trimethyl-2H-pyridine is sourced from PubChem (CID 22890213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).