C13H19N2O- — CID 22890958
butyl-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)azanide (PubChem CID 22890958) has the molecular formula C13H19N2O- and a molecular weight of 219.31 g/mol. Its IUPAC name is butyl-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)azanide.
| Compound Name | butyl-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)azanide |
|---|---|
| PubChem CID | 22890958 |
| Molecular Formula | C13H19N2O- |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | butyl-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)azanide |
| SMILES | CCCC[N-]C1CCCc2[nH]c(=O)ccc21 |
| InChI | InChI=1S/C13H19N2O/c1-2-3-9-14-11-5-4-6-12-10(11)7-8-13(16)15-12/h7-8,11H,2-6,9H2,1H3,(H,15,16)/q-1 |
| InChIKey | UILAWHIRKICMJL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|