C42H43F6N3O3 — CID 22891339
9-[5-[[4-[[hydroxy-[2-[4-(trifluoromethyl)phenyl]phenyl]methyl]amino]cyclohexanecarbonyl]amino]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22891339) has the molecular formula C42H43F6N3O3 and a molecular weight of 751.81 g/mol. Its IUPAC name is 9-[5-[[4-[[hydroxy-[2-[4-(trifluoromethyl)phenyl]phenyl]methyl]amino]cyclohexanecarbonyl]amino]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[5-[[4-[[hydroxy-[2-[4-(trifluoromethyl)phenyl]phenyl]methyl]amino]cyclohexanecarbonyl]amino]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891339 |
| Molecular Formula | C42H43F6N3O3 |
| Molecular Weight | 751.81 g/mol |
| Exact Mass | 751.32 |
| IUPAC Name | 9-[5-[[4-[[hydroxy-[2-[4-(trifluoromethyl)phenyl]phenyl]methyl]amino]cyclohexanecarbonyl]amino]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NCCCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21)C1CCC(NC(O)c2ccccc2-c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C42H43F6N3O3/c43-41(44,45)26-50-39(54)40(35-14-6-4-11-32(35)33-12-5-7-15-36(33)40)24-8-1-9-25-49-37(52)28-18-22-30(23-19-28)51-38(53)34-13-3-2-10-31(34)27-16-20-29(21-17-27)42(46,47)48/h2-7,10-17,20-21,28,30,38,51,53H,1,8-9,18-19,22-26H2,(H,49,52)(H,50,54) |
| InChIKey | CUIUUJPWBXWHTA-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.81 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|