C69H63F3N5O4P — CID 22891367
9-[5-[bis[2-(1-tritylimidazol-2-yl)ethoxy]phosphoryl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22891367) has the molecular formula C69H63F3N5O4P and a molecular weight of 1114.26 g/mol. Its IUPAC name is 9-[5-[bis[2-(1-tritylimidazol-2-yl)ethoxy]phosphoryl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[5-[bis[2-(1-tritylimidazol-2-yl)ethoxy]phosphoryl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891367 |
| Molecular Formula | C69H63F3N5O4P |
| Molecular Weight | 1114.26 g/mol |
| Exact Mass | 1113.46 |
| IUPAC Name | 9-[5-[bis[2-(1-tritylimidazol-2-yl)ethoxy]phosphoryl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CCCCCP(=O)(OCCc2nccn2C(c2ccccc2)(c2ccccc2)c2ccccc2)OCCc2nccn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C69H63F3N5O4P/c70-67(71,72)52-75-65(78)66(61-40-22-20-38-59(61)60-39-21-23-41-62(60)66)44-24-7-25-51-82(79,80-49-42-63-73-45-47-76(63)68(53-26-8-1-9-27-53,54-28-10-2-11-29-54)55-30-12-3-13-31-55)81-50-43-64-74-46-48-77(64)69(56-32-14-4-15-33-56,57-34-16-5-17-35-57)58-36-18-6-19-37-58/h1-6,8-23,26-41,45-48H,7,24-25,42-44,49-52H2,(H,75,78) |
| InChIKey | AQQAGQRHIQLZAY-UHFFFAOYSA-N |
| XLogP | 14.98 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1114.26 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|