C33H33F3N3O4P — CID 22891373
9-[5-[bis(pyridin-4-ylmethoxy)phosphoryl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 22891373) has the molecular formula C33H33F3N3O4P and a molecular weight of 623.61 g/mol. Its IUPAC name is 9-[5-[bis(pyridin-4-ylmethoxy)phosphoryl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[5-[bis(pyridin-4-ylmethoxy)phosphoryl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891373 |
| Molecular Formula | C33H33F3N3O4P |
| Molecular Weight | 623.61 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | 9-[5-[bis(pyridin-4-ylmethoxy)phosphoryl]pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CCCCCP(=O)(OCc2ccncc2)OCc2ccncc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H33F3N3O4P/c34-33(35,36)24-39-31(40)32(29-10-4-2-8-27(29)28-9-3-5-11-30(28)32)16-6-1-7-21-44(41,42-22-25-12-17-37-18-13-25)43-23-26-14-19-38-20-15-26/h2-5,8-15,17-20H,1,6-7,16,21-24H2,(H,39,40) |
| InChIKey | QAYMYIGXGKPPLK-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.61 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|